About ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate
ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 11665966) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| PubChem CID | 11665966 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1CC(c2ccc(CC)cc2)=NO1 |
| InChI | InChI=1S/C14H17NO3/c1-3-10-5-7-11(8-6-10)12-9-13(18-15-12)14(16)17-4-2/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | MIEGXKBSFPHNFV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (CID 11665966) is ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is CCOC(=O)C1CC(c2ccc(CC)cc2)=NO1.
What is the InChIKey of ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is MIEGXKBSFPHNFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-3-10-5-7-11(8-6-10)12-9-13(18-15-12)14(16)17-4-2/h5-8,13H,3-4,9H2,1-2H3.
What are the key properties of ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 247.29 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-ethylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 11665966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).