C16H20O — CID 116659694
2-(cyclohexen-1-yl)-1-(2,5-dimethylphenyl)ethanone (PubChem CID 116659694) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-(2,5-dimethylphenyl)ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-(2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 116659694 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-(2,5-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C)c(C(=O)CC2=CCCCC2)c1 |
| InChI | InChI=1S/C16H20O/c1-12-8-9-13(2)15(10-12)16(17)11-14-6-4-3-5-7-14/h6,8-10H,3-5,7,11H2,1-2H3 |
| InChIKey | BJGKKHXTIGNYFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|