C16H29N — CID 116662255
N-[[1-(cyclohexen-1-yl)-2-methylcyclopentyl]methyl]propan-1-amine (PubChem CID 116662255) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-[[1-(cyclohexen-1-yl)-2-methylcyclopentyl]methyl]propan-1-amine.
| Compound Name | N-[[1-(cyclohexen-1-yl)-2-methylcyclopentyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 116662255 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-[[1-(cyclohexen-1-yl)-2-methylcyclopentyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(C2=CCCCC2)CCCC1C |
| InChI | InChI=1S/C16H29N/c1-3-12-17-13-16(11-7-8-14(16)2)15-9-5-4-6-10-15/h9,14,17H,3-8,10-13H2,1-2H3 |
| InChIKey | BBBQVDGZKUCJCS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|