C18H33N — CID 116662377
N-[[1-(cyclohexen-1-yl)-3-propan-2-ylcyclobutyl]methyl]-2-methylpropan-1-amine (PubChem CID 116662377) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is N-[[1-(cyclohexen-1-yl)-3-propan-2-ylcyclobutyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(cyclohexen-1-yl)-3-propan-2-ylcyclobutyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 116662377 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-[[1-(cyclohexen-1-yl)-3-propan-2-ylcyclobutyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(C2=CCCCC2)CC(C(C)C)C1 |
| InChI | InChI=1S/C18H33N/c1-14(2)12-19-13-18(10-16(11-18)15(3)4)17-8-6-5-7-9-17/h8,14-16,19H,5-7,9-13H2,1-4H3 |
| InChIKey | IMGDKSRNDXNTIC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|