C16H21NO3 — CID 11666273
(1R,5S)-8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 11666273) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1R,5S)-8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5S)-8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 11666273 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1R,5S)-8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | COc1cc(N2[C@@H]3CC=C[C@H]2CC3)cc(OC)c1OC |
| InChI | InChI=1S/C16H21NO3/c1-18-14-9-13(10-15(19-2)16(14)20-3)17-11-5-4-6-12(17)8-7-11/h4-5,9-12H,6-8H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | BBBODRFDLPAPDF-NWDGAFQWSA-N |
| XLogP | 3.01 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|