C17H30OSi — CID 11666301
[(1aS,4aR,5R,7S,8aR)-4a-methyl-7-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-yl]-trimethylsilane (PubChem CID 11666301) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is [(1aS,4aR,5R,7S,8aR)-4a-methyl-7-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-yl]-trimethylsilane.
| Compound Name | [(1aS,4aR,5R,7S,8aR)-4a-methyl-7-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11666301 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(1aS,4aR,5R,7S,8aR)-4a-methyl-7-propan-2-yl-1a,4,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-yl]-trimethylsilane |
| SMILES | CC(C)[C@@H]1C[C@@H]([Si](C)(C)C)[C@]2(C)CC=C[C@@H]3O[C@@]32C1 |
| InChI | InChI=1S/C17H30OSi/c1-12(2)13-10-15(19(4,5)6)16(3)9-7-8-14-17(16,11-13)18-14/h7-8,12-15H,9-11H2,1-6H3/t13-,14+,15-,16+,17+/m1/s1 |
| InChIKey | PQIKCVHMDFMKBP-ALYAQQCSSA-N |
| XLogP | 4.86 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|