About [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone
[4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone (PubChem CID 116663176) has the molecular formula C12H18N4OS2
and a molecular weight of 298.44 g/mol. Its IUPAC name is [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone.
Molecular Properties
| Compound Name | [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone |
| PubChem CID | 116663176 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone |
| SMILES | Nc1nc(NC2CC2)sc1C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C12H18N4OS2/c13-10-9(19-12(15-10)14-8-2-3-8)11(17)16-4-1-6-18-7-5-16/h8H,1-7,13H2,(H,14,15) |
| InChIKey | GIFNKYPYCZWGTL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone?
The IUPAC name of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone (CID 116663176) is [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone.
What is the SMILES notation for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone?
The canonical SMILES for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone is Nc1nc(NC2CC2)sc1C(=O)N1CCCSCC1.
What is the InChIKey of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone?
The InChIKey is GIFNKYPYCZWGTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS2/c13-10-9(19-12(15-10)14-8-2-3-8)11(17)16-4-1-6-18-7-5-16/h8H,1-7,13H2,(H,14,15).
What are the key properties of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone?
[4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone has a molecular weight of 298.44 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(1,4-thiazepan-4-yl)methanone is sourced from PubChem (CID 116663176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).