About 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole
6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole (PubChem CID 11666319) has the molecular formula C17H16N2S
and a molecular weight of 280.40 g/mol. Its IUPAC name is 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole |
| PubChem CID | 11666319 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole |
| SMILES | CN1Cc2ccccc2C(c2ccc3cnsc3c2)C1 |
| InChI | InChI=1S/C17H16N2S/c1-19-10-14-4-2-3-5-15(14)16(11-19)12-6-7-13-9-18-20-17(13)8-12/h2-9,16H,10-11H2,1H3 |
| InChIKey | AQEBNLPGUGBPPZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole?
The IUPAC name of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole (CID 11666319) is 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole.
What is the SMILES notation for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole?
The canonical SMILES for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole is CN1Cc2ccccc2C(c2ccc3cnsc3c2)C1.
What is the InChIKey of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole?
The InChIKey is AQEBNLPGUGBPPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2S/c1-19-10-14-4-2-3-5-15(14)16(11-19)12-6-7-13-9-18-20-17(13)8-12/h2-9,16H,10-11H2,1H3.
What are the key properties of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole?
6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole has a molecular weight of 280.40 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,2-benzothiazole is sourced from PubChem (CID 11666319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).