C14H23N5OS — CID 116664088
4-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(propylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116664088) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(propylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(propylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116664088 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(propylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CCCNc1nc(N)c(C(=O)NC2CCN3CCCC23)s1 |
| InChI | InChI=1S/C14H23N5OS/c1-2-6-16-14-18-12(15)11(21-14)13(20)17-9-5-8-19-7-3-4-10(9)19/h9-10H,2-8,15H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | HWKIVWRYODAEQP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |