C11H17F3N4O2S — CID 116664480
4-amino-N-ethyl-2-(2-methoxyethylamino)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide (PubChem CID 116664480) has the molecular formula C11H17F3N4O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 4-amino-N-ethyl-2-(2-methoxyethylamino)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-ethyl-2-(2-methoxyethylamino)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116664480 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-amino-N-ethyl-2-(2-methoxyethylamino)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1sc(NCCOC)nc1N |
| InChI | InChI=1S/C11H17F3N4O2S/c1-3-18(6-11(12,13)14)9(19)7-8(15)17-10(21-7)16-4-5-20-2/h3-6,15H2,1-2H3,(H,16,17) |
| InChIKey | JWBRVHJWAUIPHK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|