C12H22N4O3S2 — CID 116664659
4-amino-2-(2-methylpropylamino)-N-(3-methylsulfonylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 116664659) has the molecular formula C12H22N4O3S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 4-amino-2-(2-methylpropylamino)-N-(3-methylsulfonylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(2-methylpropylamino)-N-(3-methylsulfonylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116664659 |
| Molecular Formula | C12H22N4O3S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-amino-2-(2-methylpropylamino)-N-(3-methylsulfonylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)CNc1nc(N)c(C(=O)NCCCS(C)(=O)=O)s1 |
| InChI | InChI=1S/C12H22N4O3S2/c1-8(2)7-15-12-16-10(13)9(20-12)11(17)14-5-4-6-21(3,18)19/h8H,4-7,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | BDIMXXYUHPJXQD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|