About 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one
2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one (PubChem CID 11666535) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one |
| PubChem CID | 11666535 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one |
| SMILES | CCc1nc2cc(O)cc(O)c2c(=O)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14N2O4/c1-2-14-17-12-7-11(20)8-13(21)15(12)16(22)18(14)9-3-5-10(19)6-4-9/h3-8,19-21H,2H2,1H3 |
| InChIKey | XPIOXZHGLYQLNZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The IUPAC name of 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one (CID 11666535) is 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one.
What is the SMILES notation for 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The canonical SMILES for 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one is CCc1nc2cc(O)cc(O)c2c(=O)n1-c1ccc(O)cc1.
What is the InChIKey of 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The InChIKey is XPIOXZHGLYQLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-2-14-17-12-7-11(20)8-13(21)15(12)16(22)18(14)9-3-5-10(19)6-4-9/h3-8,19-21H,2H2,1H3.
What are the key properties of 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one has a molecular weight of 298.30 g/mol, XLogP of 2.06, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one is sourced from PubChem (CID 11666535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).