C17H23NO4 — CID 11666657
1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]cyclopropan-1-amine (PubChem CID 11666657) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]cyclopropan-1-amine.
| Compound Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 11666657 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]cyclopropan-1-amine |
| SMILES | CC1(C)O[C@H]2O[C@H](C3(N)CC3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H23NO4/c1-16(2)21-13-12(19-10-11-6-4-3-5-7-11)14(17(18)8-9-17)20-15(13)22-16/h3-7,12-15H,8-10,18H2,1-2H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | JXCRCXKFFPWBJV-APIJFGDWSA-N |
| XLogP | 1.94 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |