C13H20N4OS — CID 116666618
4-amino-2-(diethylamino)-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 116666618) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-amino-2-(diethylamino)-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(diethylamino)-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116666618 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-amino-2-(diethylamino)-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1sc(N(CC)CC)nc1N |
| InChI | InChI=1S/C13H20N4OS/c1-6-13(4,5)16-11(18)9-10(14)15-12(19-9)17(7-2)8-3/h1H,7-8,14H2,2-5H3,(H,16,18) |
| InChIKey | CSFLUSNMGVJFPA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|