About 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide
4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 116666657) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 116666657 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)c1sc(NC2CCC2)nc1N)c1cccnc1 |
| InChI | InChI=1S/C14H17N5OS/c1-19(10-6-3-7-16-8-10)13(20)11-12(15)18-14(21-11)17-9-4-2-5-9/h3,6-9H,2,4-5,15H2,1H3,(H,17,18) |
| InChIKey | GWWVHNAMYSZNDZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide (CID 116666657) is 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide is CN(C(=O)c1sc(NC2CCC2)nc1N)c1cccnc1.
What is the InChIKey of 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The InChIKey is GWWVHNAMYSZNDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5OS/c1-19(10-6-3-7-16-8-10)13(20)11-12(15)18-14(21-11)17-9-4-2-5-9/h3,6-9H,2,4-5,15H2,1H3,(H,17,18).
What are the key properties of 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide has a molecular weight of 303.39 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(cyclobutylamino)-N-methyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 116666657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).