C8H13N5OS — CID 116668857
4-amino-2-piperazin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 116668857) has the molecular formula C8H13N5OS and a molecular weight of 227.29 g/mol. Its IUPAC name is 4-amino-2-piperazin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116668857 |
| Molecular Formula | C8H13N5OS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4-amino-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(N2CCNCC2)nc1N |
| InChI | InChI=1S/C8H13N5OS/c9-6-5(7(10)14)15-8(12-6)13-3-1-11-2-4-13/h11H,1-4,9H2,(H2,10,14) |
| InChIKey | YLSULIIIOAHEMJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |