About [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone
[4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone (PubChem CID 116670981) has the molecular formula C14H24N4OS
and a molecular weight of 296.44 g/mol. Its IUPAC name is [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone |
| PubChem CID | 116670981 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CCCN(C)c1nc(N)c(C(=O)N2CC(C)C(C)C2)s1 |
| InChI | InChI=1S/C14H24N4OS/c1-5-6-17(4)14-16-12(15)11(20-14)13(19)18-7-9(2)10(3)8-18/h9-10H,5-8,15H2,1-4H3 |
| InChIKey | DGLDRXHVPNVUAL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone?
The IUPAC name of [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone (CID 116670981) is [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone.
What is the SMILES notation for [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone?
The canonical SMILES for [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone is CCCN(C)c1nc(N)c(C(=O)N2CC(C)C(C)C2)s1.
What is the InChIKey of [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone?
The InChIKey is DGLDRXHVPNVUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4OS/c1-5-6-17(4)14-16-12(15)11(20-14)13(19)18-7-9(2)10(3)8-18/h9-10H,5-8,15H2,1-4H3.
What are the key properties of [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone?
[4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone has a molecular weight of 296.44 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-[methyl(propyl)amino]-1,3-thiazol-5-yl]-(3,4-dimethylpyrrolidin-1-yl)methanone is sourced from PubChem (CID 116670981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).