C10H14N4OS — CID 116671884
4-amino-2-(dimethylamino)-N-methyl-N-prop-2-ynyl-1,3-thiazole-5-carboxamide (PubChem CID 116671884) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 4-amino-2-(dimethylamino)-N-methyl-N-prop-2-ynyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(dimethylamino)-N-methyl-N-prop-2-ynyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116671884 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-amino-2-(dimethylamino)-N-methyl-N-prop-2-ynyl-1,3-thiazole-5-carboxamide |
| SMILES | C#CCN(C)C(=O)c1sc(N(C)C)nc1N |
| InChI | InChI=1S/C10H14N4OS/c1-5-6-14(4)9(15)7-8(11)12-10(16-7)13(2)3/h1H,6,11H2,2-4H3 |
| InChIKey | PPFKWSGZPVLJAC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|