About 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol
4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol (PubChem CID 11667199) has the molecular formula C20H24N4O
and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol |
| PubChem CID | 11667199 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol |
| SMILES | CN(C)c1nnc(-c2ccc(C(C)(C)C)cc2)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-20(2,3)15-8-6-14(7-9-15)18-21-22-19(23(4)5)24(18)16-10-12-17(25)13-11-16/h6-13,25H,1-5H3 |
| InChIKey | ZKNXMCKPBXLKLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol?
The IUPAC name of 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol (CID 11667199) is 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol.
What is the SMILES notation for 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol?
The canonical SMILES for 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol is CN(C)c1nnc(-c2ccc(C(C)(C)C)cc2)n1-c1ccc(O)cc1.
What is the InChIKey of 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol?
The InChIKey is ZKNXMCKPBXLKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O/c1-20(2,3)15-8-6-14(7-9-15)18-21-22-19(23(4)5)24(18)16-10-12-17(25)13-11-16/h6-13,25H,1-5H3.
What are the key properties of 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol?
4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol has a molecular weight of 336.44 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-tert-butylphenyl)-5-(dimethylamino)-1,2,4-triazol-4-yl]phenol is sourced from PubChem (CID 11667199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).