C12H20N4OS — CID 116672061
4-amino-2-(diethylamino)-N-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide (PubChem CID 116672061) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-amino-2-(diethylamino)-N-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(diethylamino)-N-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672061 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-amino-2-(diethylamino)-N-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCN(C)C(=O)c1sc(N(CC)CC)nc1N |
| InChI | InChI=1S/C12H20N4OS/c1-5-8-15(4)11(17)9-10(13)14-12(18-9)16(6-2)7-3/h5H,1,6-8,13H2,2-4H3 |
| InChIKey | OYUNRXSPPXRZFJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|