C15H24N4OS — CID 116672146
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[4-amino-2-(2-methylpropylamino)-1,3-thiazol-5-yl]methanone (PubChem CID 116672146) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[4-amino-2-(2-methylpropylamino)-1,3-thiazol-5-yl]methanone.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[4-amino-2-(2-methylpropylamino)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 116672146 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[4-amino-2-(2-methylpropylamino)-1,3-thiazol-5-yl]methanone |
| SMILES | CC(C)CNc1nc(N)c(C(=O)N2CC3CCCC3C2)s1 |
| InChI | InChI=1S/C15H24N4OS/c1-9(2)6-17-15-18-13(16)12(21-15)14(20)19-7-10-4-3-5-11(10)8-19/h9-11H,3-8,16H2,1-2H3,(H,17,18) |
| InChIKey | HDYJGLLMGSTENC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |