C12H19F3N4OS — CID 116672188
4-amino-2-(propan-2-ylamino)-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-carboxamide (PubChem CID 116672188) has the molecular formula C12H19F3N4OS and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-amino-2-(propan-2-ylamino)-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(propan-2-ylamino)-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672188 |
| Molecular Formula | C12H19F3N4OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-amino-2-(propan-2-ylamino)-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NCCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H19F3N4OS/c1-7(2)18-11-19-9(16)8(21-11)10(20)17-6-4-3-5-12(13,14)15/h7H,3-6,16H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | ISXVEPGRGQUEFJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|