C10H16N6O2S — CID 116672311
4-amino-N-[2-(carbamoylamino)ethyl]-2-(cyclopropylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116672311) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-amino-N-[2-(carbamoylamino)ethyl]-2-(cyclopropylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(cyclopropylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672311 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(cyclopropylamino)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1sc(NC2CC2)nc1N |
| InChI | InChI=1S/C10H16N6O2S/c11-7-6(8(17)13-3-4-14-9(12)18)19-10(16-7)15-5-1-2-5/h5H,1-4,11H2,(H,13,17)(H,15,16)(H3,12,14,18) |
| InChIKey | VLEIUYZUMDNCAM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|