C11H17N5OS — CID 116674057
4-amino-2-(3-aminopyrrolidin-1-yl)-N-prop-2-enyl-1,3-thiazole-5-carboxamide (PubChem CID 116674057) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-amino-2-(3-aminopyrrolidin-1-yl)-N-prop-2-enyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(3-aminopyrrolidin-1-yl)-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116674057 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-amino-2-(3-aminopyrrolidin-1-yl)-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1sc(N2CCC(N)C2)nc1N |
| InChI | InChI=1S/C11H17N5OS/c1-2-4-14-10(17)8-9(13)15-11(18-8)16-5-3-7(12)6-16/h2,7H,1,3-6,12-13H2,(H,14,17) |
| InChIKey | ZXHNAYCKHFCTFB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|