About N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine
N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 116674112) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine |
| PubChem CID | 116674112 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCNCCC1C=CCC1 |
| InChI | InChI=1S/C13H26N2/c1-12(2)11-15-10-9-14-8-7-13-5-3-4-6-13/h3,5,12-15H,4,6-11H2,1-2H3 |
| InChIKey | INAIHYNJPUMXKN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The IUPAC name of N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine (CID 116674112) is N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine.
What is the SMILES notation for N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The canonical SMILES for N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine is CC(C)CNCCNCCC1C=CCC1.
What is the InChIKey of N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine?
The InChIKey is INAIHYNJPUMXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-12(2)11-15-10-9-14-8-7-13-5-3-4-6-13/h3,5,12-15H,4,6-11H2,1-2H3.
What are the key properties of N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine?
N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine has a molecular weight of 210.36 g/mol, XLogP of 2.18, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopent-2-en-1-ylethyl)-N'-(2-methylpropyl)ethane-1,2-diamine is sourced from PubChem (CID 116674112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).