About N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine
N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine (PubChem CID 116674153) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 116674153 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)CCC1C=CCC1 |
| InChI | InChI=1S/C10H20N2/c1-12(9-7-11)8-6-10-4-2-3-5-10/h2,4,10H,3,5-9,11H2,1H3 |
| InChIKey | ZEMYTUQTYXZWON-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine (CID 116674153) is N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine is CN(CCN)CCC1C=CCC1.
What is the InChIKey of N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine?
The InChIKey is ZEMYTUQTYXZWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-12(9-7-11)8-6-10-4-2-3-5-10/h2,4,10H,3,5-9,11H2,1H3.
What are the key properties of N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine?
N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine has a molecular weight of 168.28 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyclopent-2-en-1-ylethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 116674153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).