C14H17N3O2 — CID 116675629
N-[4-(2-amino-2-oxoethyl)phenyl]-2-(azetidin-3-ylidene)propanamide (PubChem CID 116675629) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-2-(azetidin-3-ylidene)propanamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-2-(azetidin-3-ylidene)propanamide |
|---|---|
| PubChem CID | 116675629 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-2-(azetidin-3-ylidene)propanamide |
| SMILES | CC(C(=O)Nc1ccc(CC(N)=O)cc1)=C1CNC1 |
| InChI | InChI=1S/C14H17N3O2/c1-9(11-7-16-8-11)14(19)17-12-4-2-10(3-5-12)6-13(15)18/h2-5,16H,6-8H2,1H3,(H2,15,18)(H,17,19) |
| InChIKey | OUAJSGBFLUHHBS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|