C11H18N2O3 — CID 116675657
methyl 2-[2-(azetidin-3-ylidene)propanoylamino]-2-methylpropanoate (PubChem CID 116675657) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl 2-[2-(azetidin-3-ylidene)propanoylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[2-(azetidin-3-ylidene)propanoylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 116675657 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | methyl 2-[2-(azetidin-3-ylidene)propanoylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)C(C)=C1CNC1 |
| InChI | InChI=1S/C11H18N2O3/c1-7(8-5-12-6-8)9(14)13-11(2,3)10(15)16-4/h12H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | HBOVSMCVNIDXDI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|