C13H20F3N3O — CID 116675893
2-(azetidin-3-ylidene)-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propanamide (PubChem CID 116675893) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propanamide.
| Compound Name | 2-(azetidin-3-ylidene)-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 116675893 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propanamide |
| SMILES | CC(C(=O)NCC1CCN(CC(F)(F)F)C1)=C1CNC1 |
| InChI | InChI=1S/C13H20F3N3O/c1-9(11-5-17-6-11)12(20)18-4-10-2-3-19(7-10)8-13(14,15)16/h10,17H,2-8H2,1H3,(H,18,20) |
| InChIKey | TUJDFWRZWUMATQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|