C16H22FN3O — CID 116676043
2-(azetidin-3-yl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 116676043) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 2-(azetidin-3-yl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 116676043 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N2CCCC2)c(F)c1)C1CNC1 |
| InChI | InChI=1S/C16H22FN3O/c1-11(12-9-18-10-12)16(21)19-13-4-5-15(14(17)8-13)20-6-2-3-7-20/h4-5,8,11-12,18H,2-3,6-7,9-10H2,1H3,(H,19,21) |
| InChIKey | FRTGRPLIQDLFEJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|