C13H12Br2O2 — CID 11667632
(1R,2R,4R,5S)-4-bromo-2-(2-bromophenyl)-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 11667632) has the molecular formula C13H12Br2O2 and a molecular weight of 360.05 g/mol. Its IUPAC name is (1R,2R,4R,5S)-4-bromo-2-(2-bromophenyl)-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1R,2R,4R,5S)-4-bromo-2-(2-bromophenyl)-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 11667632 |
| Molecular Formula | C13H12Br2O2 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | (1R,2R,4R,5S)-4-bromo-2-(2-bromophenyl)-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1O[C@H]2C[C@@H]1[C@H](c1ccccc1Br)C[C@H]2Br |
| InChI | InChI=1S/C13H12Br2O2/c14-10-4-2-1-3-7(10)8-5-11(15)12-6-9(8)13(16)17-12/h1-4,8-9,11-12H,5-6H2/t8-,9+,11+,12-/m0/s1 |
| InChIKey | FORBTARUIKCERZ-SPFNVWMYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|