C8H7Br2FO3S — CID 11667659
2-(18F)fluoroethyl 3,4-dibromobenzenesulfonate (PubChem CID 11667659) has the molecular formula C8H7Br2FO3S and a molecular weight of 361.02 g/mol. Its IUPAC name is 2-(18F)fluoroethyl 3,4-dibromobenzenesulfonate.
| Compound Name | 2-(18F)fluoroethyl 3,4-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 11667659 |
| Molecular Formula | C8H7Br2FO3S |
| Molecular Weight | 361.02 g/mol |
| Exact Mass | 358.85 |
| IUPAC Name | 2-(18F)fluoroethyl 3,4-dibromobenzenesulfonate |
| SMILES | O=S(=O)(OCC[18F])c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C8H7Br2FO3S/c9-7-2-1-6(5-8(7)10)15(12,13)14-4-3-11/h1-2,5H,3-4H2/i11-1 |
| InChIKey | UFSWOINJLFJUOZ-KXMUYVCJSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.02 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|