C21H19F3N2O — CID 11667874
trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 11667874) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11667874 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CC(F)(F)CC[C@H]1c1ccccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19F3N2O/c22-15-7-5-14(6-8-15)16-3-1-2-4-17(16)18-9-10-21(23,24)13-19(18)20(27)26-12-11-25/h1-8,18-19H,9-10,12-13H2,(H,26,27)/t18-,19+/m0/s1 |
| InChIKey | ZVLQAJSIMPOGGG-RBUKOAKNSA-N |
| XLogP | 4.65 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|