C20H25NO4S — CID 11667938
(4aR,10aS,11aS)-8-(4-methylphenyl)sulfonyl-3,4,4a,6,7,9,10,10a,11,11a-decahydropyrano[3,4-h][3]benzazepin-1-one (PubChem CID 11667938) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is (4aR,10aS,11aS)-8-(4-methylphenyl)sulfonyl-3,4,4a,6,7,9,10,10a,11,11a-decahydropyrano[3,4-h][3]benzazepin-1-one.
| Compound Name | (4aR,10aS,11aS)-8-(4-methylphenyl)sulfonyl-3,4,4a,6,7,9,10,10a,11,11a-decahydropyrano[3,4-h][3]benzazepin-1-one |
|---|---|
| PubChem CID | 11667938 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (4aR,10aS,11aS)-8-(4-methylphenyl)sulfonyl-3,4,4a,6,7,9,10,10a,11,11a-decahydropyrano[3,4-h][3]benzazepin-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3=C[C@H]4CCOC(=O)[C@H]4C[C@H]3CC2)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-14-2-4-18(5-3-14)26(23,24)21-9-6-15-12-17-8-11-25-20(22)19(17)13-16(15)7-10-21/h2-5,12,16-17,19H,6-11,13H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | UTRKAYHDJTVMIQ-LMMKCTJWSA-N |
| XLogP | 2.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|