About 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine
4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine (PubChem CID 116680473) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine |
| PubChem CID | 116680473 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(CCC2CNC2)CCS1 |
| InChI | InChI=1S/C11H22N2S/c1-11(2)9-13(5-6-14-11)4-3-10-7-12-8-10/h10,12H,3-9H2,1-2H3 |
| InChIKey | MWFPEONQEFHMJY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine?
The IUPAC name of 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine (CID 116680473) is 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine.
What is the SMILES notation for 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine?
The canonical SMILES for 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine is CC1(C)CN(CCC2CNC2)CCS1.
What is the InChIKey of 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine?
The InChIKey is MWFPEONQEFHMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-11(2)9-13(5-6-14-11)4-3-10-7-12-8-10/h10,12H,3-9H2,1-2H3.
What are the key properties of 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine?
4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine has a molecular weight of 214.38 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(azetidin-3-yl)ethyl]-2,2-dimethylthiomorpholine is sourced from PubChem (CID 116680473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).