About 15-phenyl-21,22-dihydroporphyrin
15-phenyl-21,22-dihydroporphyrin (PubChem CID 11668166) has the molecular formula C26H18N4
and a molecular weight of 386.46 g/mol. Its IUPAC name is 15-phenyl-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 15-phenyl-21,22-dihydroporphyrin |
| PubChem CID | 11668166 |
| Molecular Formula | C26H18N4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 15-phenyl-21,22-dihydroporphyrin |
| SMILES | C1=Cc2nc1cc1ccc(cc3ccc(cc4nc(c2-c2ccccc2)C=C4)[nH]3)[nH]1 |
| InChI | InChI=1S/C26H18N4/c1-2-4-17(5-3-1)26-24-12-10-22(29-24)15-20-8-6-18(27-20)14-19-7-9-21(28-19)16-23-11-13-25(26)30-23/h1-16,27-28H/b18-14-,19-14-,20-15-,21-16-,22-15-,23-16-,26-24-,26-25- |
| InChIKey | YTUMONCEWKLIJU-LQIRNWTPSA-N |
| XLogP | 6.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 15-phenyl-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-phenyl-21,22-dihydroporphyrin?
The IUPAC name of 15-phenyl-21,22-dihydroporphyrin (CID 11668166) is 15-phenyl-21,22-dihydroporphyrin.
What is the SMILES notation for 15-phenyl-21,22-dihydroporphyrin?
The canonical SMILES for 15-phenyl-21,22-dihydroporphyrin is C1=Cc2nc1cc1ccc(cc3ccc(cc4nc(c2-c2ccccc2)C=C4)[nH]3)[nH]1.
What is the InChIKey of 15-phenyl-21,22-dihydroporphyrin?
The InChIKey is YTUMONCEWKLIJU-LQIRNWTPSA-N. The full InChI is InChI=1S/C26H18N4/c1-2-4-17(5-3-1)26-24-12-10-22(29-24)15-20-8-6-18(27-20)14-19-7-9-21(28-19)16-23-11-13-25(26)30-23/h1-16,27-28H/b18-14-,19-14-,20-15-,21-16-,22-15-,23-16-,26-24-,26-25-.
What are the key properties of 15-phenyl-21,22-dihydroporphyrin?
15-phenyl-21,22-dihydroporphyrin has a molecular weight of 386.46 g/mol, XLogP of 6.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 15-phenyl-21,22-dihydroporphyrin is sourced from PubChem (CID 11668166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).