C18H24ClFO6 — CID 11668264
(2S,3R,4R,5S,6S)-2-[4-chloro-3-(3-methoxycyclopentyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 11668264) has the molecular formula C18H24ClFO6 and a molecular weight of 390.84 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-(3-methoxycyclopentyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(3-methoxycyclopentyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11668264 |
| Molecular Formula | C18H24ClFO6 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(3-methoxycyclopentyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | COC1CCC(Oc2cc([C@@H]3O[C@H](CF)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)C1 |
| InChI | InChI=1S/C18H24ClFO6/c1-24-10-3-4-11(7-10)25-13-6-9(2-5-12(13)19)18-17(23)16(22)15(21)14(8-20)26-18/h2,5-6,10-11,14-18,21-23H,3-4,7-8H2,1H3/t10?,11?,14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | NWGQELVRWFVYQE-SNIKWMIRSA-N |
| XLogP | 1.78 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |