About 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole
2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole (PubChem CID 11668411) has the molecular formula C19H12N2OS
and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole |
| PubChem CID | 11668411 |
| Molecular Formula | C19H12N2OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole |
| SMILES | c1coc(-c2ccc(-c3cn4c(n3)sc3ccccc34)cc2)c1 |
| InChI | InChI=1S/C19H12N2OS/c1-2-6-18-16(4-1)21-12-15(20-19(21)23-18)13-7-9-14(10-8-13)17-5-3-11-22-17/h1-12H |
| InChIKey | ZNEQCBOUSBKZMB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole?
The IUPAC name of 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole (CID 11668411) is 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole.
What is the SMILES notation for 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole?
The canonical SMILES for 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole is c1coc(-c2ccc(-c3cn4c(n3)sc3ccccc34)cc2)c1.
What is the InChIKey of 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole?
The InChIKey is ZNEQCBOUSBKZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2OS/c1-2-6-18-16(4-1)21-12-15(20-19(21)23-18)13-7-9-14(10-8-13)17-5-3-11-22-17/h1-12H.
What are the key properties of 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole?
2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole has a molecular weight of 316.39 g/mol, XLogP of 5.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(furan-2-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole is sourced from PubChem (CID 11668411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).