About 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine
4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine (PubChem CID 11668476) has the molecular formula C22H28N2O3S
and a molecular weight of 400.54 g/mol. Its IUPAC name is 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine.
Molecular Properties
| Compound Name | 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine |
| PubChem CID | 11668476 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine |
| SMILES | COc1ccc(O[C@@H]2CN(c3ccc(OC)cc3)[C@@H]2CN2CCSCC2)cc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-25-18-5-3-17(4-6-18)24-16-22(21(24)15-23-11-13-28-14-12-23)27-20-9-7-19(26-2)8-10-20/h3-10,21-22H,11-16H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | DWVLPQQPVNEELP-FGZHOGPDSA-N |
| XLogP | 3.39 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine?
The IUPAC name of 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine (CID 11668476) is 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine.
What is the SMILES notation for 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine?
The canonical SMILES for 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine is COc1ccc(O[C@@H]2CN(c3ccc(OC)cc3)[C@@H]2CN2CCSCC2)cc1.
What is the InChIKey of 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine?
The InChIKey is DWVLPQQPVNEELP-FGZHOGPDSA-N. The full InChI is InChI=1S/C22H28N2O3S/c1-25-18-5-3-17(4-6-18)24-16-22(21(24)15-23-11-13-28-14-12-23)27-20-9-7-19(26-2)8-10-20/h3-10,21-22H,11-16H2,1-2H3/t21-,22-/m1/s1.
What are the key properties of 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine?
4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine has a molecular weight of 400.54 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,3R)-3-(4-methoxyphenoxy)-1-(4-methoxyphenyl)azetidin-2-yl]methyl]thiomorpholine is sourced from PubChem (CID 11668476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).