C14H17ClFNO — CID 116685194
1-(3-chloro-4-fluorophenyl)-2-(6-methylpiperidin-2-yl)ethanone (PubChem CID 116685194) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-2-(6-methylpiperidin-2-yl)ethanone.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-2-(6-methylpiperidin-2-yl)ethanone |
|---|---|
| PubChem CID | 116685194 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-2-(6-methylpiperidin-2-yl)ethanone |
| SMILES | CC1CCCC(CC(=O)c2ccc(F)c(Cl)c2)N1 |
| InChI | InChI=1S/C14H17ClFNO/c1-9-3-2-4-11(17-9)8-14(18)10-5-6-13(16)12(15)7-10/h5-7,9,11,17H,2-4,8H2,1H3 |
| InChIKey | MYAMTXUPVDCZPC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |