C22H32O7 — CID 11668660
5-O-[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 1-O-methyl pentanedioate (PubChem CID 11668660) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is 5-O-[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 1-O-methyl pentanedioate.
| Compound Name | 5-O-[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 1-O-methyl pentanedioate |
|---|---|
| PubChem CID | 11668660 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 5-O-[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] 1-O-methyl pentanedioate |
| SMILES | COC(=O)CCCC(=O)O[C@@H]1C[C@H]2[C@H](O)/C=C/C(=O)O[C@@H](C)CCC/C=C/[C@@H]2C1 |
| InChI | InChI=1S/C22H32O7/c1-15-7-4-3-5-8-16-13-17(29-21(25)10-6-9-20(24)27-2)14-18(16)19(23)11-12-22(26)28-15/h5,8,11-12,15-19,23H,3-4,6-7,9-10,13-14H2,1-2H3/b8-5+,12-11+/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | DQTOEHRRZHWKST-PRZXDKJUSA-N |
| XLogP | 2.86 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|