C17H29NO2S — CID 116687003
tert-butyl 2-(5-tert-butyl-2-cyanocyclohexyl)sulfanylacetate (PubChem CID 116687003) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is tert-butyl 2-(5-tert-butyl-2-cyanocyclohexyl)sulfanylacetate.
| Compound Name | tert-butyl 2-(5-tert-butyl-2-cyanocyclohexyl)sulfanylacetate |
|---|---|
| PubChem CID | 116687003 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl 2-(5-tert-butyl-2-cyanocyclohexyl)sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSC1CC(C(C)(C)C)CCC1C#N |
| InChI | InChI=1S/C17H29NO2S/c1-16(2,3)13-8-7-12(10-18)14(9-13)21-11-15(19)20-17(4,5)6/h12-14H,7-9,11H2,1-6H3 |
| InChIKey | CSQOLJNRHHBUIL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |