C15H15F2NO2S — CID 116687077
tert-butyl 3-amino-5-(2,4-difluorophenyl)thiophene-2-carboxylate (PubChem CID 116687077) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is tert-butyl 3-amino-5-(2,4-difluorophenyl)thiophene-2-carboxylate.
| Compound Name | tert-butyl 3-amino-5-(2,4-difluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 116687077 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | tert-butyl 3-amino-5-(2,4-difluorophenyl)thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1sc(-c2ccc(F)cc2F)cc1N |
| InChI | InChI=1S/C15H15F2NO2S/c1-15(2,3)20-14(19)13-11(18)7-12(21-13)9-5-4-8(16)6-10(9)17/h4-7H,18H2,1-3H3 |
| InChIKey | OWMUTXWNJYQMIC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |