C13H17NO4S — CID 116687408
2-amino-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 116687408) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-amino-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2-amino-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 116687408 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-amino-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | CC(C)(C)OC(=O)CSc1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C13H17NO4S/c1-13(2,3)18-11(15)7-19-8-4-5-9(12(16)17)10(14)6-8/h4-6H,7,14H2,1-3H3,(H,16,17) |
| InChIKey | LSWJZSVMZBPVPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|