C12H22O5S — CID 116688131
tert-butyl 2-(3,3-dimethyl-2-oxobutyl)sulfonylacetate (PubChem CID 116688131) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is tert-butyl 2-(3,3-dimethyl-2-oxobutyl)sulfonylacetate.
| Compound Name | tert-butyl 2-(3,3-dimethyl-2-oxobutyl)sulfonylacetate |
|---|---|
| PubChem CID | 116688131 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | tert-butyl 2-(3,3-dimethyl-2-oxobutyl)sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O5S/c1-11(2,3)9(13)7-18(15,16)8-10(14)17-12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | CRODWVWLERXCJL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |