C14H13F2NO2S — CID 116688226
tert-butyl 3-(2,4-difluorophenyl)-1,2-thiazole-5-carboxylate (PubChem CID 116688226) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is tert-butyl 3-(2,4-difluorophenyl)-1,2-thiazole-5-carboxylate.
| Compound Name | tert-butyl 3-(2,4-difluorophenyl)-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 116688226 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | tert-butyl 3-(2,4-difluorophenyl)-1,2-thiazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(-c2ccc(F)cc2F)ns1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-14(2,3)19-13(18)12-7-11(17-20-12)9-5-4-8(15)6-10(9)16/h4-7H,1-3H3 |
| InChIKey | YYQOSAZHPWWSGR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |