C12H19N3O2S — CID 116688327
tert-butyl 2-[6-(ethylamino)pyrimidin-4-yl]sulfanylacetate (PubChem CID 116688327) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is tert-butyl 2-[6-(ethylamino)pyrimidin-4-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[6-(ethylamino)pyrimidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 116688327 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl 2-[6-(ethylamino)pyrimidin-4-yl]sulfanylacetate |
| SMILES | CCNc1cc(SCC(=O)OC(C)(C)C)ncn1 |
| InChI | InChI=1S/C12H19N3O2S/c1-5-13-9-6-10(15-8-14-9)18-7-11(16)17-12(2,3)4/h6,8H,5,7H2,1-4H3,(H,13,14,15) |
| InChIKey | QWADIRMNXZPRAN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |