C15H12ClFN2O2 — CID 116689293
6-(3-chloro-2-fluorophenoxy)-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 116689293) has the molecular formula C15H12ClFN2O2 and a molecular weight of 306.72 g/mol. Its IUPAC name is 6-(3-chloro-2-fluorophenoxy)-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-(3-chloro-2-fluorophenoxy)-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116689293 |
| Molecular Formula | C15H12ClFN2O2 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-(3-chloro-2-fluorophenoxy)-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(Oc3cccc(Cl)c3F)ccc21 |
| InChI | InChI=1S/C15H12ClFN2O2/c1-18-14-9-6-5-8(7-11(9)19-15(14)20)21-12-4-2-3-10(16)13(12)17/h2-7,14,18H,1H3,(H,19,20) |
| InChIKey | OIWWZOZDSNCNJT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |