C16H18ClFN2O — CID 116689574
N-[[6-(3-chloro-2-fluorophenoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 116689574) has the molecular formula C16H18ClFN2O and a molecular weight of 308.78 g/mol. Its IUPAC name is N-[[6-(3-chloro-2-fluorophenoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[6-(3-chloro-2-fluorophenoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 116689574 |
| Molecular Formula | C16H18ClFN2O |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[[6-(3-chloro-2-fluorophenoxy)-3-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(Oc2cccc(Cl)c2F)nc1 |
| InChI | InChI=1S/C16H18ClFN2O/c1-11(2)8-19-9-12-6-7-15(20-10-12)21-14-5-3-4-13(17)16(14)18/h3-7,10-11,19H,8-9H2,1-2H3 |
| InChIKey | OHTWGWKWECLGSV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |