C18H19ClINO — CID 11669109
3-chloro-7-methyl-6,8,9,13b-tetrahydro-5H-isoquinolino[1,2-a]isoquinolin-7-ium-2-ol iodide (PubChem CID 11669109) has the molecular formula C18H19ClINO and a molecular weight of 427.71 g/mol. Its IUPAC name is 3-chloro-7-methyl-6,8,9,13b-tetrahydro-5H-isoquinolino[1,2-a]isoquinolin-7-ium-2-ol iodide.
| Compound Name | 3-chloro-7-methyl-6,8,9,13b-tetrahydro-5H-isoquinolino[1,2-a]isoquinolin-7-ium-2-ol iodide |
|---|---|
| PubChem CID | 11669109 |
| Molecular Formula | C18H19ClINO |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 3-chloro-7-methyl-6,8,9,13b-tetrahydro-5H-isoquinolino[1,2-a]isoquinolin-7-ium-2-ol iodide |
| SMILES | C[N+]12CCc3ccccc3C1c1cc(O)c(Cl)cc1CC2.[I-] |
| InChI | InChI=1S/C18H18ClNO.HI/c1-20-8-6-12-4-2-3-5-14(12)18(20)15-11-17(21)16(19)10-13(15)7-9-20;/h2-5,10-11,18H,6-9H2,1H3;1H |
| InChIKey | LLUIZQLDEKEYEH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|